Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 21:07:47 UTC
Update Date2025-10-07 16:04:39 UTC
Metabolite IDMMDBc0002949
Metabolite Identification
Common NameBafilomycin B1
DescriptionBafilomycin B1 is a plecomacrolide antibiotic belonging to the class of V-ATPase inhibitors. This compound has garnered attention in both chemistry and biology due to its significant role in modulating cellular processes. Bafilomycin B1 is produced by certain microorganisms and is known for its ability to inhibit vacuolar ATPases (V-ATPases), which are crucial for various cellular functions, including ion transport and pH regulation. In studies involving type 2 diabetic rats, bafilomycin B1 demonstrated a reduction in renal V-ATPase activity, leading to decreased urinary ammonium excretion and altered insulin secretion dynamics (PMID:32382157 ). Furthermore, it has been shown to enhance the efficacy of azole antifungal agents against Candida species, indicating its potential therapeutic applications (PMID:30673768 ). The compound also plays a role in the degradation of phosphorylated tau proteins in neuronal cells, highlighting its relevance in neurobiology (PMID:30010136 ). Overall, bafilomycin B1 serves as a valuable tool in both biochemical research and potential therapeutic interventions, particularly in metabolic and neurodegenerative disorders.
Structure
Synonyms
ValueSource
Bafilomycin-b1MeSH
Molecular FormulaC44H65NO13
Average Mass815.998
Monoisotopic Mass815.445591157
IUPAC Name(2E)-4-[(2-hydroxy-2-{3-hydroxy-4-[(4E,6E,12E,14Z)-10-hydroxy-3,15-dimethoxy-7,9,11,13-tetramethyl-16-oxo-1-oxacyclohexadeca-4,6,12,14-tetraen-2-yl]pentan-2-yl}-5-methyl-6-(propan-2-yl)oxan-4-yl)oxy]-N-(2-hydroxy-5-oxocyclopent-1-en-1-yl)-4-oxobut-2-enimidic acid
Traditional Name(2E)-4-[(2-hydroxy-2-{3-hydroxy-4-[(4E,6E,12E,14Z)-10-hydroxy-3,15-dimethoxy-7,9,11,13-tetramethyl-16-oxo-1-oxacyclohexadeca-4,6,12,14-tetraen-2-yl]pentan-2-yl}-6-isopropyl-5-methyloxan-4-yl)oxy]-N-(2-hydroxy-5-oxocyclopent-1-en-1-yl)-4-oxobut-2-enimidic acid
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])C(O)=NC1=C(O)CCC1=O)C(=O)OC1CC(O)(OC(C(C)C)C1C)C(C)C(O)C(C)C1OC(=O)\C(OC)=C(/[H])\C(\C)=C([H])\C(C)C(O)C(C)C\C(C)=C(/[H])\C(\[H])=C([H])\C1OC
InChI Identifier
InChI=1S/C44H65NO13/c1-23(2)41-28(7)35(56-37(49)18-17-36(48)45-38-31(46)15-16-32(38)47)22-44(53,58-41)30(9)40(51)29(8)42-33(54-10)14-12-13-24(3)19-26(5)39(50)27(6)20-25(4)21-34(55-11)43(52)57-42/h12-14,17-18,20-21,23,26-30,33,35,39-42,46,50-51,53H,15-16,19,22H2,1-11H3,(H,45,48)/b14-12+,18-17+,24-13+,25-20+,34-21-
InChI KeyKFUFLYSBMNNJTF-UNPKUBMASA-N