Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:40:24 UTC
Update Date2025-10-07 16:05:45 UTC
Metabolite IDMMDBc0010521
Metabolite Identification
Common NameOctahydroheptaprenol
DescriptionOctahydroheptaprenol is a cyclic terpenoid belonging to the chemical class of polyisoprenoids. This compound has garnered attention in the field of biochemistry due to its unique structure, which features three Z-double bonds. It is a metabolite that has been isolated from various biological sources, highlighting its potential significance in natural product chemistry. Specifically, octahydroheptaprenol was obtained from six different species, indicating its widespread occurrence and possibly diverse biological roles. The isolation of octahydroheptaprenol, alongside other novel cyclic compounds such as heptaprenylcycline, underscores the richness of natural terpenoid chemistry and its implications for understanding metabolic pathways in various organisms (PMID:18843409 ). As research continues, the exploration of octahydroheptaprenol may reveal further insights into its biological functions and applications in pharmacology or biotechnology.
Structure
SynonymsNot Available
Molecular FormulaC35H66O
Average Mass502.912
Monoisotopic Mass502.511366745
IUPAC Name(2Z,6Z,10Z)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10-trien-1-ol
Traditional Name(2Z,6Z,10Z)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10-trien-1-ol
CAS Registry NumberNot Available
SMILES
[H]\C(CO)=C(/C)CC\C([H])=C(\C)CC\C([H])=C(\C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C
InChI Identifier
InChI=1S/C35H66O/c1-29(2)15-9-16-30(3)17-10-18-31(4)19-11-20-32(5)21-12-22-33(6)23-13-24-34(7)25-14-26-35(8)27-28-36/h23,25,27,29-32,36H,9-22,24,26,28H2,1-8H3/b33-23-,34-25-,35-27-
InChI KeyJJWZVZDLRKZUPU-SLKBRMTOSA-N