Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-11-19 04:57:39 UTC
Update Date2025-10-07 16:04:17 UTC
Metabolite IDMMDBc0033655
Metabolite Identification
Common NameHopeaphenol
DescriptionHopeaphenol is a tetramer of the natural polyphenol resveratrol, belonging to the chemical class of polyphenolic compounds. Its chemical structure consists of multiple phenolic units, which contribute to its enhanced biological activity compared to resveratrol. Research indicates that hopeaphenol plays a significant role in cardiac hypertrophy, a condition characterized by the enlargement of heart muscle cells. In vivo studies using transverse aortic constriction (TAC) models have demonstrated that hopeaphenol treatment improves cardiac function indices, restores cardiomyocyte morphology, and reduces fibrosis, suggesting its cardioprotective properties (PMID:41010549 ). The underlying mechanism involves the activation of the AMPK signaling pathway, as evidenced by the direct interaction between hopeaphenol and AMPK confirmed through Cellular Thermal Shift Assay (CETSA) (PMID:41010549 ). In vitro experiments further support this, showing that hopeaphenol reduces Ang II-induced hypertrophy and apoptosis in HL-1 cardiomyocytes while enhancing mitochondrial membrane potential and decreasing reactive oxygen species (ROS) levels (PMID:41010549 ). Overall, hopeaphenol's cardioprotective effects are closely linked to its ability to activate AMPK, which mitigates mitochondrial dysfunction and alleviates heart failure resulting from pressure overload (PMID:41010549 ).
Structure
SynonymsNot Available
Molecular FormulaC56H42O12
Average Mass906.9255
Monoisotopic Mass906.267626808
IUPAC Name(1R,8S,9R,16R)-8,16-bis(4-hydroxyphenyl)-9-[(1R,8R,9S,16R)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2,4,6,10,12,14(17)-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2,4,6,10,12,14(17)-hexaene-4,6,12-triol
Traditional Name(1R,8S,9R,16R)-8,16-bis(4-hydroxyphenyl)-9-[(1R,8R,9S,16R)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2,4,6,10,12,14(17)-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2,4,6,10,12,14(17)-hexaene-4,6,12-triol
CAS Registry Number17912-85-5
SMILES
OC1=CC=C(C=C1)[C@@H]1OC2=C3[C@H]1C1=CC(O)=CC(O)=C1[C@@H]([C@@H]([C@H]1[C@H](C4=CC=C(O)C=C4)C4=C(O)C=C(O)C=C4[C@H]4[C@@H](OC5=C4C1=CC(O)=C5)C1=CC=C(O)C=C1)C3=CC(O)=C2)C1=CC=C(O)C=C1
InChI Identifier
InChI=1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46+,51-,52+,53-,54-,55+,56+/m1/s1
InChI KeyYQQUILZPDYJDQJ-VHXTUJGLSA-N