Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:59:28 UTC
Update Date2025-10-07 16:09:12 UTC
Metabolite IDMMDBc0055582
Metabolite Identification
Common Name5-oxopentanoic acid
Description5-oxopentanoic acid is a metabolite classified as a carboxylic acid. Its chemical structure features a five-carbon backbone with a ketone functional group at the second carbon, contributing to its reactivity and involvement in various biochemical pathways. This compound is often synthesized or modified in laboratory settings, as seen in studies where it serves as a precursor or component in the formation of more complex molecules. For instance, it has been utilized in the synthesis of derivatives such as 5-(2,4-ditert-butylphenoxy)-5-oxopentanoic acid (PMID:39142619 ) and has been involved in reactions with metal complexes, where it influences the formation of coordination compounds (PMID:33360106 ). Additionally, it has applications in polymer chemistry, evidenced by its use as a chain transfer agent in the synthesis of thermo-responsive polymers (PMID:32326302 ). These pathways highlight the compound's versatility in chemical synthesis and its potential roles in various research applications, although its specific biological significance remains to be fully elucidated.
Structure
Synonyms
ValueSource
5-OxovalerateChEBI
5-Oxovaleric acidGenerator
5-Oxopentanoic acidGenerator
Molecular FormulaC5H7O3
Average Mass115.109
Monoisotopic Mass115.040067665
IUPAC Name5-oxopentanoate
Traditional Name5-oxopentanoate
CAS Registry NumberNot Available
SMILES
[O-]C(=O)CCCC=O
InChI Identifier
InChI=1S/C5H8O3/c6-4-2-1-3-5(7)8/h4H,1-3H2,(H,7,8)/p-1
InChI KeyVBKPPDYGFUZOAJ-UHFFFAOYSA-M