MMDBr0012860 | (2R)-2-phosphoglyceric acid | Phosphoenolpyruvic acid | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012943 | Xanthylic acid | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012944 | Phosphoribosyl pyrophosphate | Xanthylic acid | Xanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | L-Aspartic acid | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Hydration/dehydration of C-O bond; Synthesis | RHEA | 34755880 |
MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
MMDBr0012975 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012976 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0012989 | D-Alanine | D-Alanyl-D-alanine | D-alanine--D-alanine ligase | Ligation | RHEA | 34755880 |
MMDBr0013001 | Acetic acid | Acetyl phosphate | Acetate kinase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0013026 | Orotidylic acid | Uridine 5'-monophosphate | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013027 | CMP | CDP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0013098 | UDP-N-acetyl-alpha-D-muramate | UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013173 | Uridine 5'-monophosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Transfer of phosphoribosyl group | RHEA | 34755880 |
MMDBr0013187 | Shikimate | Shikimate 3-phosphate | Pentafunctional AROM polypeptide | Phosphorylation | RHEA | 34755880 |
MMDBr0013194 | Porphobilinogen | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0013224 | N-acetyl-alpha-D-glucosamine 1-phosphate | Uridine diphosphate-N-acetylglucosamine | Bifunctional protein GlmU | N-Acetylation; Phosphorylation; Isomerization | RHEA | 34755880 |
MMDBr0013226 | 5-Thymidylic acid | dTDP | Putative thymidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Isomerization | RHEA | 34755880 |
MMDBr0013248 | alpha-D-Glucosamine 1-phosphate | N-acetyl-alpha-D-glucosamine 1-phosphate | Bifunctional protein GlmU | N-Acetylation | RHEA | 34755880 |
MMDBr0013280 | D-Arabinose 5-phosphate | 3-deoxy-alpha-D-manno-2-octulosonate-8-phosphate | 2-dehydro-3-deoxyphosphooctonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013333 | N-Acetylglutamic acid | N-Acetyl-L-glutamyl 5-phosphate | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013370 | L-Glutamic acid | gamma-L-Glutamyl 5-phosphate | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013408 | 1-Deoxy-D-xylulose 5-phosphate | Pyridoxine 5'-phosphate | Pyridoxine 5'-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013416 | L-Glutamic acid | Ornithine | Arginine biosynthesis bifunctional protein ArgJ | Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013469 | Co-sirohydrochlorin | Cobalt | Sirohydrochlorin cobaltochelatase | Chelation | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013529 | D-Glutamate | UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamic acid | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0013547 | Uridine triphosphate | Cytidine triphosphate | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013580 | (S)-8-amino-7-oxononanoic acid | (7R,8S)-7,8-diammoniononanoic acid | Adenosylmethionine-8-amino-7-oxononanoate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Hydrolysis | RHEA | 34755880 |
MMDBr0013664 | ADP-D-glycero-beta-D-manno-heptose | ADP-L-glycero-beta-D-manno-heptose | ADP-L-glycero-D-manno-heptose-6-epimerase | Epimerization | RHEA | 34755880 |
MMDBr0013708 | Inosinic acid | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of phosphoribosyl group; Synthesis | RHEA | 34755880 |
MMDBr0013709 | Phosphoribosyl pyrophosphate | Inosinic acid | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013720 | Phosphonate | Phosphonate | Phosphonates import ATP-binding protein PhnC | Phosphonates | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013771 | D-Ribulose 5-phosphate | L-3,4-Dihydroxybutan-2-one 4-phosphate | 3,4-dihydroxy-2-butanone 4-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
MMDBr0013801 | Phosphoenolpyruvic acid | UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0013805 | hydrogenselenide | Selenophosphate | Selenide, water dikinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013840 | Siroheme | 12,18-didecarboxysiroheme | Siroheme decarboxylase alpha subunit | Decarboxylation | RHEA | 34755880 |
MMDBr0013886 | Carbamoylphosphate | Citrulline | Ornithine carbamoyltransferase | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013895 | L-Glutamic-gamma-semialdehyde | gamma-L-Glutamyl 5-phosphate | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; Hydrolysis; Nucleic acid synthesis and/or repair | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Dephosphorylation | RHEA | 34755880 |
MMDBr0013941 | S-Methyl-5-thio-alpha-D-ribose 1-phosphate | 5-Methylthioribulose 1-phosphate | 5-deoxyribose 1-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | N-carbamoyl-L-aspartate | Protein pyrABCN | Transfer of a carbamoyl group | RHEA | 34755880 |
MMDBr0013952 | 1-(5-phosphoribosyl)-5'-AMP | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | Histidine biosynthesis bifunctional protein HisIE | Hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0013970 | L-Alanine | D-Alanine | L-alanine/L-glutamate racemase | Racemization | RHEA | 34755880 |
MMDBr0014024 | S-Adenosylhomocysteine | S-inosyl-L-homocysteine | 5'-deoxyadenosine deaminase | Deamination | RHEA | 34755880 |
MMDBr0014035 | GMP | Guanosine diphosphate | Guanylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014087 | superoxide | Hydrogen peroxide | Desulfoferrodoxin | Reduction | RHEA | 34755880 |
MMDBr0014126 | Glycerol | Glycerol 3-phosphate | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014135 | S-Adenosylhomocysteine | Deoxyadenosine | Adenosylhomocysteinase | Reversible hydrolysis | RHEA | 34755880 |
MMDBr0014159 | Formamide | formate | Formamidase | Amide hydrolysis | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Isomerization | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014323 | L-Alanine | UDP-N-acetyl-alpha-D-muramoyl-L-alanine | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0014337 | 3-deoxy-D-manno-2-octulosonate | CMP-3-deoxy-beta-D-manno-octulosonate | 3-deoxy-manno-octulosonate cytidylyltransferase | Transfer of a cytidylyl group | RHEA | 34755880 |
MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Transfer of ribazole | RHEA | 34755880 |
MMDBr0014367 | Adenine | Hypoxanthine | Adenine deaminase | Deamination | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Reversible cyclization | RHEA | 34755880 |
MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014405 | LL-2,6-Diaminoheptanedioate | (S)-2,3,4,5-tetrahydrodipicolinate | LL-diaminopimelate aminotransferase | Amine group addition | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
MMDBr0014436 | L-Glutamic acid | N-Acetylglutamic acid | Amino-acid acetyltransferase | Acetylation; Synthesis | RHEA | 34755880 |
MMDBr0014442 | Siroheme | Sirohydrochlorin | Sirohydrochlorin cobaltochelatase CbiKC | Synthesis | RHEA | 34755880 |
MMDBr0014447 | Uridine 5'-monophosphate | Uridine 5'-diphosphate | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014486 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014487 | (R)-2,3-Dihydroxy-isovalerate | alpha-Ketoisovaleric acid | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014489 | formate | N(2)-formyl-N(1)-(5-phospho-beta-D-ribosyl)glycinamide | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0014490 | formate | N(2)-formyl-N(1)-(5-phospho-beta-D-ribosyl)glycinamide | Formate-dependent phosphoribosylglycinamide formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0014505 | 5'-Methylthioadenosine | S-methyl-5'-thioinosine | 5'-deoxyadenosine deaminase | Deamination | RHEA | 34755880 |
MMDBr0014514 | dCMP | dCDP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014556 | GMP | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014557 | Phosphoribosyl pyrophosphate | GMP | Hypoxanthine-guanine phosphoribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014633 | Co-precorrin-5B | Co-precorrin-6A | Cobalt-precorrin-5B C(1)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017926 | L-Glutamine | Cytidine triphosphate | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0014688 | D-Sedoheptulose 7-phosphate | D-glycero-alpha-D-manno-heptose 7-phosphate | Phosphoheptose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014718 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014719 | (R)-2,3-Dihydroxy-3-methylpentanoate | 2-Keto-3-methyl-valerate | Dihydroxy-acid dehydratase, mitochondrial | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0014761 | 6-Carboxy-5,6,7,8-tetrahydropterin | 7-Deaza-7-carboxyguanine | 7-carboxy-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014763 | 7-Deaza-7-carboxyguanine | 7-Cyano-7-carbaguanine | 7-cyano-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014776 | Farnesyl pyrophosphate | Fe(II)-heme o | Protoheme IX farnesyltransferase, mitochondrial | Farnesylation | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation | RHEA | 34755880 |
MMDBr0014816 | 2'-Deoxyinosine triphosphate | DIMP | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transfer of phospho-N-acetylmuramoyl-pentapeptide | RHEA | 34755880 |
MMDBr0014846 | Thymidine 5'-triphosphate | 5-Thymidylic acid | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014848 | Xanthosine 5-triphosphate | Xanthylic acid | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014891 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Flavin-dependent thymidylate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014908 | Uridine triphosphate | Uridine 5'-monophosphate | dTTP/UTP pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0014909 | Inosine triphosphate | Inosinic acid | Inosine triphosphate pyrophosphatase | Dephosphorylation | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0015133 | 3-Isopropylmalate | Ketoleucine | 3-isopropylmalate dehydrogenase AMT6 | Dehydrogenation | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Isomerization | RHEA | 34755880 |
MMDBr0015316 | L-Aspartate-semialdehyde | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
MMDBr0016462 | (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | Cyclic pyranopterin monophosphate | Cyclic pyranopterin monophosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0016813 | 2-Aminobenzoic acid | 2-(4-dimethylaminophenyl)diazenylbenzoic acid | FMN-dependent NADPH-azoreductase | Reduction | RHEA | 34755880 |
MMDBr0017992 | Fe-coproporphyrin III | 5'-Deoxyadenosine | AdoMet-dependent heme synthase | Synthesis | RHEA | 34755880 |
MMDBr0017077 | isethionate | Acetaldehyde | Isethionate sulfite-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0017078 | isethionate | Acetaldehyde | Isethionate sulfite-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | Synthesis | RHEA | 34755880 |
MMDBr0017843 | L-Glutamine | GMP | GMP synthase [glutamine-hydrolyzing] | Synthesis | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017874 | L-Glutamine | L-Glutamic acid | Thermolabile glutaminase | Synthesis | RHEA | 34755880 |
MMDBr0017882 | Hydrogen carbonate | Carbamoylphosphate | Carbamoyl-phosphate synthase small chain | Synthesis | RHEA | 34755880 |
MMDBr0017886 | L-Tryptophan | Indole | Probable tryptophanase | Non-hydrolytic bond cleavage | RHEA | 34755880 |
MMDBr0017894 | L-Histidinol | L-Histidine | Histidinol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0017897 | L-Methionine | S-Adenosylmethionine | S-adenosylmethionine synthase | Synthesis | RHEA | 34755880 |
MMDBr0017898 | 5-methyltetrahydropteroyltri-L-glutamate | L-Methionine | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | Synthesis | RHEA | 34755880 |
MMDBr0024345 | L-Tyrosine | Hydrogen Ion | Tyrosine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024360 | L-Valine | diphosphate | Valine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024368 | L-Isoleucine | diphosphate | Isoleucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024371 | L-Asparagine | Hydrogen Ion | Asparagine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024389 | L-Leucine | diphosphate | Leucine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024401 | L-Serine | Adenosine 3',5'-diphosphate | Holo-[acyl-carrier-protein] synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
MMDBr0024403 | Hydrogen Ion | Carbon dioxide | 3-oxoacyl-[acyl-carrier-protein] synthase 3 | Synthesis | RHEA | 34755880 |
MMDBr0024411 | L-Serine | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | Reduction | RHEA | 34755880 |
MMDBr0024418 | L-Alanine | diphosphate | Alanine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024424 | S-Adenosylmethionine | S-Adenosylhomocysteine | Protein-L-isoaspartate O-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0024474 | L-Proline | diphosphate | Proline--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024483 | L-Glutamine | L-Glutamic acid | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024522 | Glycine | diphosphate | Glycine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024533 | L-Glutamine | Ammonium | Probable chemoreceptor glutamine deamidase CheD | Deamidation | RHEA | 34755880 |
MMDBr0024539 | Tetra-mu3-sulfido-tetrairon(2+) | 5'-Deoxyadenosine | Lipoyl synthase | Synthesis | RHEA | 34755880 |
MMDBr0024546 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | Methylation | RHEA | 34755880 |
MMDBr0024559 | Adenosine triphosphate | Hydrogen Ion | Histidine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024566 | Hydrogen | di-mu-Sulfido-diiron(1+) | Membrane-bound hydrogenase subunit alpha | Hydrogenation | RHEA | 34755880 |
MMDBr0024568 | L-Glutamine | L-Glutamic acid | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | Amide group addition | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | Synthesis | RHEA | 34755880 |
MMDBr0024597 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp/Asn) ligase | Ligation | RHEA | 34755880 |
MMDBr0024628 | L-Phenylalanine | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | Ligation | RHEA | 34755880 |
MMDBr0024630 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase A | Methylation | RHEA | 34755880 |
MMDBr0024656 | L-Arginine | diphosphate | Arginine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024706 | Water | Hydroxylamine | Hydroxylamine reductase | Reduction | RHEA | 34755880 |
MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | Synthesis | RHEA | 34755880 |
MMDBr0024721 | Selenophosphate | Phosphate | L-seryl-tRNA(Sec) selenium transferase | Transfer of L-seryl-tRNA(Sec) selenium | RHEA | 34755880 |
MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024765 | 7-Aminomethyl-7-carbaguanine | Guanine | Putative queuine tRNA-ribosyltransferase | Transfer of a ribosyl group | RHEA | 34755880 |
MMDBr0024768 | L-Methionine | L-Cysteine | Peptide methionine sulfoxide reductase MsrB | Reduction | RHEA | 34755880 |
MMDBr0024774 | Glycine | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | Dehydrogenation | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Methionyl-tRNA formyltransferase | Transfer of a formyl group | RHEA | 34755880 |
MMDBr0024782 | di-mu-Sulfido-diiron(2+) | di-mu-Sulfido-diiron(1+) | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024787 | L-Threonine | Hydrogen Ion | Threonine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0024789 | di-mu-Sulfido-diiron(2+) | di-mu-Sulfido-diiron(1+) | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | Transfer of a dimethylallyl group | RHEA | 34755880 |
MMDBr0024883 | S-Adenosylmethionine | Adenine | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | Isomerization | RHEA | 34755880 |
MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | Acylation | RHEA | 34755880 |
MMDBr0024967 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine(37)-N1)-methyltransferase Trm5b | Methylation | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | Synthesis | RHEA | 34755880 |
MMDBr0024974 | S-Adenosylmethionine | 5'-Deoxyadenosine | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | Synthesis | RHEA | 34755880 |
MMDBr0024977 | S-Adenosylmethionine | 5'-Deoxyadenosine | Ribosomal protein S12 methylthiotransferase RimO | Methylthiolation | RHEA | 34755880 |
MMDBr0025060 | L-Serine | Hydrogen Ion | Type-2 serine--tRNA ligase | Ligation | RHEA | 34755880 |
MMDBr0025075 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA large subunit methyltransferase E | Methylation | RHEA | 34755880 |
MMDBr0025078 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase G | Methylation | RHEA | 34755880 |
MMDBr0025085 | S-Adenosylmethionine | S-Adenosylhomocysteine | Putative ribosomal RNA large subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025097 | L-Glutamine | S-Adenosylhomocysteine | Release factor glutamine methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | Methylation | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase H | Methylation | RHEA | 34755880 |
MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | Methylation | RHEA | 34755880 |
MMDBr0025167 | L-Lysine | Hydrogen Ion | tRNA(Ile)-lysidine synthase | Synthesis | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0025257 | Hydrogen sulfide | L-Cysteine | Sulfite reductase, dissimilatory-type subunit alpha | Reduction | RHEA | 34755880 |
MMDBr0025258 | Uridine 5'-monophosphate | L-Cysteine | tRNA-specific 2-thiouridylase MnmA | 2-Thiolation of uridine | RHEA | 34755880 |
MMDBr0025620 | L-Cysteine | Sn-Glycerol-1-phosphate | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | Transfer of the diacylglyceryl group | RHEA | 34755880 |
MMDBr0025766 | Glycine | 5'-Deoxyadenosine | Putative glycyl-radical enzyme activating enzyme MJ1227 | Reduction; Synthesis | RHEA | 34755880 |
MMDBr0025767 | Glycine | 5'-Deoxyadenosine | Isethionate sulfite-lyase activating enzyme | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0025777 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | Methylation | RHEA | 34755880 |
MMDBr0025921 | Hydrogen Ion | NAD | FMN-dependent NADH:quinone oxidoreductase | Redox reaction | RHEA | 34755880 |
MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |